About (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten
(C,N-dimethylcarbonimidoyl)-methylazanide;tungsten (PubChem CID 58400091) has the molecular formula C4H9N2W-
and a molecular weight of 268.97 g/mol. Its IUPAC name is (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten.
Molecular Properties
| Compound Name | (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten |
| PubChem CID | 58400091 |
| Molecular Formula | C4H9N2W- |
| Molecular Weight | 268.97 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten |
| SMILES | C/N=C(\C)[N-]C.[W] |
| InChI | InChI=1S/C4H9N2.W/c1-4(5-2)6-3;/h1-3H3;/q-1; |
| InChIKey | BBWIRIANDUZLKF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.97 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten?
The IUPAC name of (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten (CID 58400091) is (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten.
What is the SMILES notation for (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten?
The canonical SMILES for (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten is C/N=C(\C)[N-]C.[W].
What is the InChIKey of (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten?
The InChIKey is BBWIRIANDUZLKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2.W/c1-4(5-2)6-3;/h1-3H3;/q-1;.
What are the key properties of (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten?
(C,N-dimethylcarbonimidoyl)-methylazanide;tungsten has a molecular weight of 268.97 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (C,N-dimethylcarbonimidoyl)-methylazanide;tungsten is sourced from PubChem (CID 58400091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).