C31H46N2O9Si — CID 58400102
methyl 2-[(2S,4R,5R)-3-amino-2-[(1S,2S,3R,6R)-3-amino-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohexyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate (PubChem CID 58400102) has the molecular formula C31H46N2O9Si and a molecular weight of 618.80 g/mol. Its IUPAC name is methyl 2-[(2S,4R,5R)-3-amino-2-[(1S,2S,3R,6R)-3-amino-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohexyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate.
| Compound Name | methyl 2-[(2S,4R,5R)-3-amino-2-[(1S,2S,3R,6R)-3-amino-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohexyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate |
|---|---|
| PubChem CID | 58400102 |
| Molecular Formula | C31H46N2O9Si |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | methyl 2-[(2S,4R,5R)-3-amino-2-[(1S,2S,3R,6R)-3-amino-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohexyl]oxy-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate |
| SMILES | COC(=O)CO[C@@H]1C(N)[C@H](O[C@@H]2[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](N)CC[C@H]2O)OC(CO)[C@@H]1O |
| InChI | InChI=1S/C31H46N2O9Si/c1-31(2,3)43(19-11-7-5-8-12-19,20-13-9-6-10-14-20)42-27-21(32)15-16-22(35)28(27)41-30-25(33)29(39-18-24(36)38-4)26(37)23(17-34)40-30/h5-14,21-23,25-30,34-35,37H,15-18,32-33H2,1-4H3/t21-,22-,23?,25?,26+,27+,28+,29-,30+/m1/s1 |
| InChIKey | YXQZHHONIQSVJT-UHJKWGPZSA-N |
| XLogP | -0.24 |
| TPSA | 175.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.80 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|