C10H18O4 — CID 58400407
(4R,6aR)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 58400407) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (4R,6aR)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (4R,6aR)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 58400407 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (4R,6aR)-5-methoxy-4-(methoxymethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | COC[C@@H]1C(OC)C[C@H]2OC(O)CC12 |
| InChI | InChI=1S/C10H18O4/c1-12-5-7-6-3-10(11)14-9(6)4-8(7)13-2/h6-11H,3-5H2,1-2H3/t6?,7-,8?,9+,10?/m0/s1 |
| InChIKey | JHKJONPBHKHCTR-VHVWPASRSA-N |
| XLogP | 0.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |