About [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate
[3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate (PubChem CID 58400479) has the molecular formula C17H20F2N2O4
and a molecular weight of 354.35 g/mol. Its IUPAC name is [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate |
| PubChem CID | 58400479 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate |
| SMILES | CC(F)(F)C(=O)OC12CC3CC(CC(OC(=O)n4ccnc4)(C3)C1)C2 |
| InChI | InChI=1S/C17H20F2N2O4/c1-15(18,19)13(22)24-16-5-11-4-12(6-16)8-17(7-11,9-16)25-14(23)21-3-2-20-10-21/h2-3,10-12H,4-9H2,1H3 |
| InChIKey | WYTNYBGFUHNMMH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate?
The IUPAC name of [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate (CID 58400479) is [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate.
What is the SMILES notation for [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate?
The canonical SMILES for [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate is CC(F)(F)C(=O)OC12CC3CC(CC(OC(=O)n4ccnc4)(C3)C1)C2.
What is the InChIKey of [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate?
The InChIKey is WYTNYBGFUHNMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2O4/c1-15(18,19)13(22)24-16-5-11-4-12(6-16)8-17(7-11,9-16)25-14(23)21-3-2-20-10-21/h2-3,10-12H,4-9H2,1H3.
What are the key properties of [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate?
[3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate has a molecular weight of 354.35 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-difluoropropanoyloxy)-1-adamantyl] imidazole-1-carboxylate is sourced from PubChem (CID 58400479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).