C14H28N2 — CID 58400649
3,6-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole (PubChem CID 58400649) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 3,6-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 3,6-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 58400649 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 3,6-ditert-butyl-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC(C)(C)C1NCC2C1CNC2C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-13(2,3)11-9-7-16-12(14(4,5)6)10(9)8-15-11/h9-12,15-16H,7-8H2,1-6H3 |
| InChIKey | TYJDSKNGSIRXEY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |