C48H48IrN4O-2 — CID 58400911
1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium (PubChem CID 58400911) has the molecular formula C48H48IrN4O-2 and a molecular weight of 889.16 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium.
| Compound Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 58400911 |
| Molecular Formula | C48H48IrN4O-2 |
| Molecular Weight | 889.16 g/mol |
| Exact Mass | 889.35 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)dibenzofuran-3-yl]-2-phenylimidazole;1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium |
| SMILES | CC(C)c1cc2c(oc3ccccc32)c(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C27H25N2O.C21H23N2.Ir/c1-17(2)21-16-22-20-12-8-9-13-23(20)30-26(22)24(18(3)4)25(21)29-15-14-28-27(29)19-10-6-5-7-11-19;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h5-10,12-18H,1-4H3;5-9,11-16H,1-4H3;/q2*-1; |
| InChIKey | PZJXNBLIPWMCJT-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.16 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|