C16H21Br2NO2S — CID 58401218
1,3-dibromo-5-(3,7-dimethyloctyl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 58401218) has the molecular formula C16H21Br2NO2S and a molecular weight of 451.22 g/mol. Its IUPAC name is 1,3-dibromo-5-(3,7-dimethyloctyl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1,3-dibromo-5-(3,7-dimethyloctyl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 58401218 |
| Molecular Formula | C16H21Br2NO2S |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | 1,3-dibromo-5-(3,7-dimethyloctyl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CC(C)CCCC(C)CCN1C(=O)c2c(Br)sc(Br)c2C1=O |
| InChI | InChI=1S/C16H21Br2NO2S/c1-9(2)5-4-6-10(3)7-8-19-15(20)11-12(16(19)21)14(18)22-13(11)17/h9-10H,4-8H2,1-3H3 |
| InChIKey | CQAAQHZSZYVFKC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|