C30H24F3N2O2Pt- — CID 58401259
(Z)-4-hydroxypent-3-en-2-one;9-[2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]-4-pyridinyl]carbazole;platinum (PubChem CID 58401259) has the molecular formula C30H24F3N2O2Pt- and a molecular weight of 696.61 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;9-[2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]-4-pyridinyl]carbazole;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;9-[2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]-4-pyridinyl]carbazole;platinum |
|---|---|
| PubChem CID | 58401259 |
| Molecular Formula | C30H24F3N2O2Pt- |
| Molecular Weight | 696.61 g/mol |
| Exact Mass | 696.14 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;9-[2-[3-methyl-5-(trifluoromethyl)benzene-6-id-1-yl]-4-pyridinyl]carbazole;platinum |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(-c2cc(-n3c4ccccc4c4ccccc43)ccn2)[c-]c(C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C25H16F3N2.C5H8O2.Pt/c1-16-12-17(14-18(13-16)25(26,27)28)22-15-19(10-11-29-22)30-23-8-4-2-6-20(23)21-7-3-5-9-24(21)30;1-4(6)3-5(2)7;/h2-13,15H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | HKHQAIHPTKDAPI-LWFKIUJUSA-N |
| XLogP | 8.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|