C27H24F6NO4Pt- — CID 58401317
[2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401317) has the molecular formula C27H24F6NO4Pt- and a molecular weight of 735.56 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401317 |
| Molecular Formula | C27H24F6NO4Pt- |
| Molecular Weight | 735.56 g/mol |
| Exact Mass | 735.13 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1-c1c[c-]c(-c2cc(CO)ccn2)c(CO)c1.[Pt] |
| InChI | InChI=1S/C22H16F6NO2.C5H8O2.Pt/c1-12-6-16(21(23,24)25)9-18(22(26,27)28)20(12)14-2-3-17(15(8-14)11-31)19-7-13(10-30)4-5-29-19;1-4(6)3-5(2)7;/h2,4-9,30-31H,10-11H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RJDVUFBBYGULDU-LWFKIUJUSA-N |
| XLogP | 6.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|