About 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum
1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum (PubChem CID 58401346) has the molecular formula C17H21N2O2Pt-
and a molecular weight of 480.45 g/mol. Its IUPAC name is 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum.
Molecular Properties
| Compound Name | 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum |
| PubChem CID | 58401346 |
| Molecular Formula | C17H21N2O2Pt- |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum |
| SMILES | CC(=O)/C(C)=C(/C)O.Cc1c(-c2[c-]cccc2)ncn1C.[Pt] |
| InChI | InChI=1S/C11H11N2.C6H10O2.Pt/c1-9-11(12-8-13(9)2)10-6-4-3-5-7-10;1-4(5(2)7)6(3)8;/h3-6,8H,1-2H3;7H,1-3H3;/q-1;;/b;5-4-; |
| InChIKey | KRENUYRQIKAJQY-FXHNQCOHSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum?
The IUPAC name of 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum (CID 58401346) is 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum.
What is the SMILES notation for 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum?
The canonical SMILES for 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum is CC(=O)/C(C)=C(/C)O.Cc1c(-c2[c-]cccc2)ncn1C.[Pt].
What is the InChIKey of 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum?
The InChIKey is KRENUYRQIKAJQY-FXHNQCOHSA-N. The full InChI is InChI=1S/C11H11N2.C6H10O2.Pt/c1-9-11(12-8-13(9)2)10-6-4-3-5-7-10;1-4(5(2)7)6(3)8;/h3-6,8H,1-2H3;7H,1-3H3;/q-1;;/b;5-4-;.
What are the key properties of 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum?
1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum has a molecular weight of 480.45 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4-phenylimidazole;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum is sourced from PubChem (CID 58401346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).