C17H11F7NO3Pt- — CID 58401375
[2-(2-fluorobenzene-6-id-1-yl)-4-pyridinyl]methanol;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;platinum (PubChem CID 58401375) has the molecular formula C17H11F7NO3Pt- and a molecular weight of 605.34 g/mol. Its IUPAC name is [2-(2-fluorobenzene-6-id-1-yl)-4-pyridinyl]methanol;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | [2-(2-fluorobenzene-6-id-1-yl)-4-pyridinyl]methanol;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 58401375 |
| Molecular Formula | C17H11F7NO3Pt- |
| Molecular Weight | 605.34 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | [2-(2-fluorobenzene-6-id-1-yl)-4-pyridinyl]methanol;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;platinum |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.OCc1ccnc(-c2[c-]cccc2F)c1.[Pt] |
| InChI | InChI=1S/C12H9FNO.C5H2F6O2.Pt/c13-11-4-2-1-3-10(11)12-7-9(8-15)5-6-14-12;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-2,4-7,15H,8H2;1,12H;/q-1;;/b;2-1-; |
| InChIKey | ADYNBMZZMUGJCS-FJOGWHKWSA-N |
| XLogP | 4.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|