C29H32F3N2O2Pt- — CID 58401445
(Z)-4-hydroxypent-3-en-2-one;N-methyl-1-[2-[3-methyl-5-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanamine;platinum (PubChem CID 58401445) has the molecular formula C29H32F3N2O2Pt- and a molecular weight of 692.66 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;N-methyl-1-[2-[3-methyl-5-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanamine;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;N-methyl-1-[2-[3-methyl-5-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanamine;platinum |
|---|---|
| PubChem CID | 58401445 |
| Molecular Formula | C29H32F3N2O2Pt- |
| Molecular Weight | 692.66 g/mol |
| Exact Mass | 692.21 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;N-methyl-1-[2-[3-methyl-5-(trifluoromethyl)-2-(2,4,6-trimethylphenyl)benzene-6-id-1-yl]-4-pyridinyl]methanamine;platinum |
| SMILES | CC(=O)/C=C(/C)O.CNCc1ccnc(-c2[c-]c(C(F)(F)F)cc(C)c2-c2c(C)cc(C)cc2C)c1.[Pt] |
| InChI | InChI=1S/C24H24F3N2.C5H8O2.Pt/c1-14-8-15(2)22(16(3)9-14)23-17(4)10-19(24(25,26)27)12-20(23)21-11-18(13-28-5)6-7-29-21;1-4(6)3-5(2)7;/h6-11,28H,13H2,1-5H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | JGVOKFHJYBEELU-LWFKIUJUSA-N |
| XLogP | 7.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|