About bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+)
bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) (PubChem CID 58401500) has the molecular formula C40H38N4Pt
and a molecular weight of 769.85 g/mol. Its IUPAC name is bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+).
Molecular Properties
| Compound Name | bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) |
| PubChem CID | 58401500 |
| Molecular Formula | C40H38N4Pt |
| Molecular Weight | 769.85 g/mol |
| Exact Mass | 769.27 |
| IUPAC Name | bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) |
| SMILES | Cc1c(-c2[c-]ccc3c2C(C)(C)c2ccccc2-3)ncn1C.Cc1c(-c2[c-]ccc3c2C(C)(C)c2ccccc2-3)ncn1C.[Pt+2] |
| InChI | InChI=1S/2C20H19N2.Pt/c2*1-13-19(21-12-22(13)4)16-10-7-9-15-14-8-5-6-11-17(14)20(2,3)18(15)16;/h2*5-9,11-12H,1-4H3;/q2*-1;+2 |
| InChIKey | XCVQOMFEDQBGTQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 769.85 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+)?
The IUPAC name of bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) (CID 58401500) is bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+).
What is the SMILES notation for bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+)?
The canonical SMILES for bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) is Cc1c(-c2[c-]ccc3c2C(C)(C)c2ccccc2-3)ncn1C.Cc1c(-c2[c-]ccc3c2C(C)(C)c2ccccc2-3)ncn1C.[Pt+2].
What is the InChIKey of bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+)?
The InChIKey is XCVQOMFEDQBGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H19N2.Pt/c2*1-13-19(21-12-22(13)4)16-10-7-9-15-14-8-5-6-11-17(14)20(2,3)18(15)16;/h2*5-9,11-12H,1-4H3;/q2*-1;+2.
What are the key properties of bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+)?
bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) has a molecular weight of 769.85 g/mol, XLogP of 9.00, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-(9,9-dimethyl-2H-fluoren-2-id-1-yl)-1,5-dimethylimidazole);platinum(2+) is sourced from PubChem (CID 58401500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).