C22H22N4O2Pt-2 — CID 58401732
2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum (PubChem CID 58401732) has the molecular formula C22H22N4O2Pt-2 and a molecular weight of 569.52 g/mol. Its IUPAC name is 2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum.
| Compound Name | 2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
|---|---|
| PubChem CID | 58401732 |
| Molecular Formula | C22H22N4O2Pt-2 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
| SMILES | COc1ccc[c-]c1-c1[n-]cc[n+]1C.Cn1ccnc1-c1[c-]cccc1CO.[Pt] |
| InChI | InChI=1S/2C11H11N2O.Pt/c1-13-8-7-12-11(13)9-5-3-4-6-10(9)14-2;1-13-7-6-12-11(13)10-5-3-2-4-9(10)8-14;/h3-4,6-8H,1-2H3;2-4,6-7,14H,8H2,1H3;/q2*-1; |
| InChIKey | QYUSASXYIXHDCS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|