C27H24F6IrNO4- — CID 58401800
[2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 58401800) has the molecular formula C27H24F6IrNO4- and a molecular weight of 732.70 g/mol. Its IUPAC name is [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 58401800 |
| Molecular Formula | C27H24F6IrNO4- |
| Molecular Weight | 732.70 g/mol |
| Exact Mass | 733.12 |
| IUPAC Name | [2-[2-(hydroxymethyl)-4-[2-methyl-4,6-bis(trifluoromethyl)phenyl]benzene-6-id-1-yl]-4-pyridinyl]methanol;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1-c1c[c-]c(-c2cc(CO)ccn2)c(CO)c1.[Ir] |
| InChI | InChI=1S/C22H16F6NO2.C5H8O2.Ir/c1-12-6-16(21(23,24)25)9-18(22(26,27)28)20(12)14-2-3-17(15(8-14)11-31)19-7-13(10-30)4-5-29-19;1-4(6)3-5(2)7;/h2,4-9,30-31H,10-11H2,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | IKBWPOSMMNGQQQ-LWFKIUJUSA-N |
| XLogP | 6.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|