C25H20F6NO2Pt- — CID 58401804
(Z)-4-hydroxypent-3-en-2-one;3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-2-phenylpyridine;platinum (PubChem CID 58401804) has the molecular formula C25H20F6NO2Pt- and a molecular weight of 675.51 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-2-phenylpyridine;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-2-phenylpyridine;platinum |
|---|---|
| PubChem CID | 58401804 |
| Molecular Formula | C25H20F6NO2Pt- |
| Molecular Weight | 675.51 g/mol |
| Exact Mass | 675.11 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;3-[4-methyl-2,6-bis(trifluoromethyl)phenyl]-2-phenylpyridine;platinum |
| SMILES | CC(=O)/C=C(/C)O.Cc1cc(C(F)(F)F)c(-c2cccnc2-c2[c-]cccc2)c(C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C20H12F6N.C5H8O2.Pt/c1-12-10-15(19(21,22)23)17(16(11-12)20(24,25)26)14-8-5-9-27-18(14)13-6-3-2-4-7-13;1-4(6)3-5(2)7;/h2-6,8-11H,1H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | VJGDFUJCPXCAMS-LWFKIUJUSA-N |
| XLogP | 7.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.51 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|