C16H27NO6 — CID 58402356
N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)propoxy]propyl]prop-2-enamide (PubChem CID 58402356) has the molecular formula C16H27NO6 and a molecular weight of 329.39 g/mol. Its IUPAC name is N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)propoxy]propyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)propoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 58402356 |
| Molecular Formula | C16H27NO6 |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)propoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)CCC(O)COC(C)COCC(O)CNC(=O)C=C |
| InChI | InChI=1S/C16H27NO6/c1-4-13(18)6-7-14(19)11-23-12(3)9-22-10-15(20)8-17-16(21)5-2/h4-5,12,14-15,19-20H,1-2,6-11H2,3H3,(H,17,21) |
| InChIKey | XPOMPBWKLKYFPK-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|