About N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide
N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide (PubChem CID 58402363) has the molecular formula C15H25NO6
and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide |
| PubChem CID | 58402363 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)CCCOCC(O)C(O)COCCNC(=O)C=C |
| InChI | InChI=1S/C15H25NO6/c1-3-12(17)6-5-8-21-10-13(18)14(19)11-22-9-7-16-15(20)4-2/h3-4,13-14,18-19H,1-2,5-11H2,(H,16,20) |
| InChIKey | CXQNZELIWFEBGN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide?
The IUPAC name of N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide (CID 58402363) is N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide.
What is the SMILES notation for N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide?
The canonical SMILES for N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide is C=CC(=O)CCCOCC(O)C(O)COCCNC(=O)C=C.
What is the InChIKey of N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide?
The InChIKey is CXQNZELIWFEBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO6/c1-3-12(17)6-5-8-21-10-13(18)14(19)11-22-9-7-16-15(20)4-2/h3-4,13-14,18-19H,1-2,5-11H2,(H,16,20).
What are the key properties of N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide?
N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide has a molecular weight of 315.37 g/mol, XLogP of -0.42, 14 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2,3-dihydroxy-4-(4-oxohex-5-enoxy)butoxy]ethyl]prop-2-enamide is sourced from PubChem (CID 58402363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).