C23H37NO9 — CID 58402368
N-[3-[2,3-bis(2-hydroxy-5-oxohept-6-enoxy)propoxy]-2-hydroxypropyl]prop-2-enamide (PubChem CID 58402368) has the molecular formula C23H37NO9 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[3-[2,3-bis(2-hydroxy-5-oxohept-6-enoxy)propoxy]-2-hydroxypropyl]prop-2-enamide.
| Compound Name | N-[3-[2,3-bis(2-hydroxy-5-oxohept-6-enoxy)propoxy]-2-hydroxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 58402368 |
| Molecular Formula | C23H37NO9 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-[3-[2,3-bis(2-hydroxy-5-oxohept-6-enoxy)propoxy]-2-hydroxypropyl]prop-2-enamide |
| SMILES | C=CC(=O)CCC(O)COCC(COCC(O)CNC(=O)C=C)OCC(O)CCC(=O)C=C |
| InChI | InChI=1S/C23H37NO9/c1-4-17(25)7-9-19(27)12-31-15-22(33-14-20(28)10-8-18(26)5-2)16-32-13-21(29)11-24-23(30)6-3/h4-6,19-22,27-29H,1-3,7-16H2,(H,24,30) |
| InChIKey | NYUYMVBTPNXOFX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|