About 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole
4-methyl-2,5-di(propan-2-yl)-2H-pyrrole (PubChem CID 58402716) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole.
Molecular Properties
| Compound Name | 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole |
| PubChem CID | 58402716 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole |
| SMILES | CC1=CC(C(C)C)N=C1C(C)C |
| InChI | InChI=1S/C11H19N/c1-7(2)10-6-9(5)11(12-10)8(3)4/h6-8,10H,1-5H3 |
| InChIKey | MGWVFZQUSQUFEF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole?
The IUPAC name of 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole (CID 58402716) is 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole.
What is the SMILES notation for 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole?
The canonical SMILES for 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole is CC1=CC(C(C)C)N=C1C(C)C.
What is the InChIKey of 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole?
The InChIKey is MGWVFZQUSQUFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-7(2)10-6-9(5)11(12-10)8(3)4/h6-8,10H,1-5H3.
What are the key properties of 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole?
4-methyl-2,5-di(propan-2-yl)-2H-pyrrole has a molecular weight of 165.28 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,5-di(propan-2-yl)-2H-pyrrole is sourced from PubChem (CID 58402716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).