About 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane
2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane (PubChem CID 58402762) has the molecular formula C13H25NS2
and a molecular weight of 259.48 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane |
| PubChem CID | 58402762 |
| Molecular Formula | C13H25NS2 |
| Molecular Weight | 259.48 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane |
| SMILES | CC(C)C1CC2(CN1C(C)C)SCCCS2 |
| InChI | InChI=1S/C13H25NS2/c1-10(2)12-8-13(9-14(12)11(3)4)15-6-5-7-16-13/h10-12H,5-9H2,1-4H3 |
| InChIKey | UCEBNGSIBMPBNY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane?
The IUPAC name of 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane (CID 58402762) is 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane.
What is the SMILES notation for 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane?
The canonical SMILES for 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane is CC(C)C1CC2(CN1C(C)C)SCCCS2.
What is the InChIKey of 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane?
The InChIKey is UCEBNGSIBMPBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NS2/c1-10(2)12-8-13(9-14(12)11(3)4)15-6-5-7-16-13/h10-12H,5-9H2,1-4H3.
What are the key properties of 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane?
2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane has a molecular weight of 259.48 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)-6,10-dithia-2-azaspiro[4.5]decane is sourced from PubChem (CID 58402762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).