C25H26FN4O9P-2 — CID 58402857
[6-[[6-deuterio-2-[(2,6-dideuterio-3,4,5-trimethoxyphenyl)methyl]-5-fluoropyrimidin-4-yl]methyl]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate (PubChem CID 58402857) has the molecular formula C25H26FN4O9P-2 and a molecular weight of 585.53 g/mol. Its IUPAC name is [6-[[6-deuterio-2-[(2,6-dideuterio-3,4,5-trimethoxyphenyl)methyl]-5-fluoropyrimidin-4-yl]methyl]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate.
| Compound Name | [6-[[6-deuterio-2-[(2,6-dideuterio-3,4,5-trimethoxyphenyl)methyl]-5-fluoropyrimidin-4-yl]methyl]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
|---|---|
| PubChem CID | 58402857 |
| Molecular Formula | C25H26FN4O9P-2 |
| Molecular Weight | 585.53 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | [6-[[6-deuterio-2-[(2,6-dideuterio-3,4,5-trimethoxyphenyl)methyl]-5-fluoropyrimidin-4-yl]methyl]-3-oxo-2,2-bis(trideuteriomethyl)pyrido[3,2-b][1,4]oxazin-4-yl]methyl phosphate |
| SMILES | [2H]c1nc(Cc2c([2H])c(OC)c(OC)c(OC)c2[2H])nc(Cc2ccc3c(n2)N(COP(=O)([O-])[O-])C(=O)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O3)c1F |
| InChI | InChI=1S/C25H28FN4O9P/c1-25(2)24(31)30(13-38-40(32,33)34)23-18(39-25)7-6-15(28-23)11-17-16(26)12-27-21(29-17)10-14-8-19(35-3)22(37-5)20(9-14)36-4/h6-9,12H,10-11,13H2,1-5H3,(H2,32,33,34)/p-2/i1D3,2D3,8D,9D,12D |
| InChIKey | NJWLBKQNQIQHFJ-AUTSCQRNSA-L |
| XLogP | 1.52 |
| TPSA | 168.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|