About 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole
5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole (PubChem CID 58403048) has the molecular formula C8H12F3N3
and a molecular weight of 207.20 g/mol. Its IUPAC name is 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole.
Molecular Properties
| Compound Name | 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole |
| PubChem CID | 58403048 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole |
| SMILES | CC(C)(C)c1cnnn1CC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3/c1-7(2,3)6-4-12-13-14(6)5-8(9,10)11/h4H,5H2,1-3H3 |
| InChIKey | CTWNRJDRWLXNCO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole?
The IUPAC name of 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole (CID 58403048) is 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole.
What is the SMILES notation for 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole?
The canonical SMILES for 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole is CC(C)(C)c1cnnn1CC(F)(F)F.
What is the InChIKey of 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole?
The InChIKey is CTWNRJDRWLXNCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3/c1-7(2,3)6-4-12-13-14(6)5-8(9,10)11/h4H,5H2,1-3H3.
What are the key properties of 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole?
5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole has a molecular weight of 207.20 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-(2,2,2-trifluoroethyl)triazole is sourced from PubChem (CID 58403048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).