C23H20F5N2O3+ — CID 58403070
(3S)-1-[2-(2,4-difluorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-4-pyridinyl]-3-(1-hydroxy-6-methylpyridin-1-ium-3-yl)butan-1-one (PubChem CID 58403070) has the molecular formula C23H20F5N2O3+ and a molecular weight of 467.41 g/mol. Its IUPAC name is (3S)-1-[2-(2,4-difluorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-4-pyridinyl]-3-(1-hydroxy-6-methylpyridin-1-ium-3-yl)butan-1-one.
| Compound Name | (3S)-1-[2-(2,4-difluorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-4-pyridinyl]-3-(1-hydroxy-6-methylpyridin-1-ium-3-yl)butan-1-one |
|---|---|
| PubChem CID | 58403070 |
| Molecular Formula | C23H20F5N2O3+ |
| Molecular Weight | 467.41 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (3S)-1-[2-(2,4-difluorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-4-pyridinyl]-3-(1-hydroxy-6-methylpyridin-1-ium-3-yl)butan-1-one |
| SMILES | Cc1ccc([C@@H](C)CC(=O)c2cc(-c3ccc(F)cc3F)nc(C(O)C(F)(F)F)c2)c[n+]1O |
| InChI | InChI=1S/C23H20F5N2O3/c1-12(14-4-3-13(2)30(33)11-14)7-21(31)15-8-19(17-6-5-16(24)10-18(17)25)29-20(9-15)22(32)23(26,27)28/h3-6,8-12,22,32-33H,7H2,1-2H3/q+1/t12-,22?/m0/s1 |
| InChIKey | PAELXRYXSWSXJW-BJDAYTSDSA-N |
| XLogP | 4.83 |
| TPSA | 74.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|