C19H30F6O5 — CID 58403302
1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 5-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 58403302) has the molecular formula C19H30F6O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 5-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 5-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58403302 |
| Molecular Formula | C19H30F6O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 5-O-(1,1,1-trifluoropropan-2-yl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC(C)C(F)(F)F)C(=O)OC(C)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C19H30F6O5/c1-8-16(6,10-15(4,5)13(26)30-12(3)18(20,21)22)14(27)29-11(2)9-17(7,28)19(23,24)25/h11-12,28H,8-10H2,1-7H3 |
| InChIKey | PMSOZUZBZLOXRY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |