C30H48F6O7 — CID 58403307
3-O-(1-ethylcyclopentyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 58403307) has the molecular formula C30H48F6O7 and a molecular weight of 634.70 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58403307 |
| Molecular Formula | C30H48F6O7 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(C)(CC(C)(C)C(=O)OC(C)C(F)(F)F)CC(C)(CC)C(=O)OC(C)CC(C)(O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C30H48F6O7/c1-10-25(7,22(38)41-19(3)16-27(9,40)30(34,35)36)18-26(8,23(39)43-28(11-2)14-12-13-15-28)17-24(5,6)21(37)42-20(4)29(31,32)33/h19-20,40H,10-18H2,1-9H3 |
| InChIKey | FHKKUMRKFXXMRM-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|