C24H39F3O6 — CID 58403312
3-O-(1-ethylcyclopentyl) 5-O-methyl 1-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 58403312) has the molecular formula C24H39F3O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 5-O-methyl 1-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 5-O-methyl 1-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58403312 |
| Molecular Formula | C24H39F3O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 5-O-methyl 1-O-(2,2,2-trifluoroethyl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(C)(CC(C)(C)C(=O)OCC(F)(F)F)CC(C)(CC)C(=O)OC)CCCC1 |
| InChI | InChI=1S/C24H39F3O6/c1-8-21(5,18(29)31-7)15-22(6,19(30)33-23(9-2)12-10-11-13-23)14-20(3,4)17(28)32-16-24(25,26)27/h8-16H2,1-7H3 |
| InChIKey | FEJMJHJHIPDHPK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|