C22H18N2O4 — CID 58403382
ethyl 5-[(3-oxo-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 58403382) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 5-[(3-oxo-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[(3-oxo-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 58403382 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 5-[(3-oxo-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(CN2C(=O)c3ccccc3C#Cc3ccccc32)C1 |
| InChI | InChI=1S/C22H18N2O4/c1-2-27-22(26)19-13-17(28-23-19)14-24-20-10-6-4-8-16(20)12-11-15-7-3-5-9-18(15)21(24)25/h3-10,17H,2,13-14H2,1H3 |
| InChIKey | OGSFDEITZMEZIH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|