About 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine
6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine (PubChem CID 58403476) has the molecular formula C6H9FO2
and a molecular weight of 132.13 g/mol. Its IUPAC name is 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine.
Molecular Properties
| Compound Name | 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine |
| PubChem CID | 58403476 |
| Molecular Formula | C6H9FO2 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine |
| SMILES | CC1=C(F)OC(C)CO1 |
| InChI | InChI=1S/C6H9FO2/c1-4-3-8-5(2)6(7)9-4/h4H,3H2,1-2H3 |
| InChIKey | HEJFQGBQDYLPHA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine?
The IUPAC name of 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine (CID 58403476) is 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine.
What is the SMILES notation for 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine?
The canonical SMILES for 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine is CC1=C(F)OC(C)CO1.
What is the InChIKey of 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine?
The InChIKey is HEJFQGBQDYLPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FO2/c1-4-3-8-5(2)6(7)9-4/h4H,3H2,1-2H3.
What are the key properties of 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine?
6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine has a molecular weight of 132.13 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,5-dimethyl-2,3-dihydro-1,4-dioxine is sourced from PubChem (CID 58403476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).