C5H7FO2 — CID 58403478
6-fluoro-2-methyl-2,3-dihydro-1,4-dioxine (PubChem CID 58403478) has the molecular formula C5H7FO2 and a molecular weight of 118.11 g/mol. Its IUPAC name is 6-fluoro-2-methyl-2,3-dihydro-1,4-dioxine.
| Compound Name | 6-fluoro-2-methyl-2,3-dihydro-1,4-dioxine |
|---|---|
| PubChem CID | 58403478 |
| Molecular Formula | C5H7FO2 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 6-fluoro-2-methyl-2,3-dihydro-1,4-dioxine |
| SMILES | CC1COC=C(F)O1 |
| InChI | InChI=1S/C5H7FO2/c1-4-2-7-3-5(6)8-4/h3-4H,2H2,1H3 |
| InChIKey | ASHJGUGJRAFVFS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |