C20H40O2 — CID 58403511
(E)-2,2,7,7-tetramethyl-5,6-bis[(2-methylpropan-2-yl)oxy]oct-3-ene (PubChem CID 58403511) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is (E)-2,2,7,7-tetramethyl-5,6-bis[(2-methylpropan-2-yl)oxy]oct-3-ene.
| Compound Name | (E)-2,2,7,7-tetramethyl-5,6-bis[(2-methylpropan-2-yl)oxy]oct-3-ene |
|---|---|
| PubChem CID | 58403511 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | (E)-2,2,7,7-tetramethyl-5,6-bis[(2-methylpropan-2-yl)oxy]oct-3-ene |
| SMILES | CC(C)(C)/C=C/C(OC(C)(C)C)C(OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H40O2/c1-17(2,3)14-13-15(21-19(7,8)9)16(18(4,5)6)22-20(10,11)12/h13-16H,1-12H3/b14-13+ |
| InChIKey | SPYZAKRSIKFZJG-BUHFOSPRSA-N |
| XLogP | 6.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|