C17H17Cl2NO5 — CID 58403523
2-[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 58403523) has the molecular formula C17H17Cl2NO5 and a molecular weight of 386.23 g/mol. Its IUPAC name is 2-[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 58403523 |
| Molecular Formula | C17H17Cl2NO5 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[2,6-dichloro-3-[(2,6-dioxocyclohexylidene)-hydroxymethyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1c(Cl)ccc(C(O)=C2C(=O)CCCC2=O)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO5/c1-20(2)13(23)8-25-17-10(18)7-6-9(15(17)19)16(24)14-11(21)4-3-5-12(14)22/h6-7,24H,3-5,8H2,1-2H3 |
| InChIKey | AOQXRFPEOGFMOO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|