C21H21ClFN3O2 — CID 58403940
tert-butyl 4-chloro-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 58403940) has the molecular formula C21H21ClFN3O2 and a molecular weight of 401.87 g/mol. Its IUPAC name is tert-butyl 4-chloro-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | tert-butyl 4-chloro-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 58403940 |
| Molecular Formula | C21H21ClFN3O2 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | tert-butyl 4-chloro-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c([nH]c3ccc(Cl)nc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H21ClFN3O2/c1-21(2,3)28-20(27)26-10-9-14-17-15(7-8-16(22)25-17)24-18(14)19(26)12-5-4-6-13(23)11-12/h4-8,11,19,24H,9-10H2,1-3H3 |
| InChIKey | DOCHZPCXRBMHBL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|