About 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole
6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole (PubChem CID 58404209) has the molecular formula C15H14BClOS
and a molecular weight of 288.61 g/mol. Its IUPAC name is 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole.
Molecular Properties
| Compound Name | 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole |
| PubChem CID | 58404209 |
| Molecular Formula | C15H14BClOS |
| Molecular Weight | 288.61 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole |
| SMILES | CB1CCc2ccc(S(=O)c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C15H14BClOS/c1-16-8-7-11-5-6-14(10-15(11)16)19(18)13-4-2-3-12(17)9-13/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | PVNAAABZDJIBFK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole?
The IUPAC name of 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole (CID 58404209) is 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole.
What is the SMILES notation for 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole?
The canonical SMILES for 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole is CB1CCc2ccc(S(=O)c3cccc(Cl)c3)cc21.
What is the InChIKey of 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole?
The InChIKey is PVNAAABZDJIBFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BClOS/c1-16-8-7-11-5-6-14(10-15(11)16)19(18)13-4-2-3-12(17)9-13/h2-6,9-10H,7-8H2,1H3.
What are the key properties of 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole?
6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole has a molecular weight of 288.61 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-chlorophenyl)sulfinyl-1-methyl-2,3-dihydro-1-benzoborole is sourced from PubChem (CID 58404209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).