C26H33ClN3O5P — CID 58404534
4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[(1S,3S)-3-diethoxyphosphorylcyclopentyl]aniline (PubChem CID 58404534) has the molecular formula C26H33ClN3O5P and a molecular weight of 533.99 g/mol. Its IUPAC name is 4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[(1S,3S)-3-diethoxyphosphorylcyclopentyl]aniline.
| Compound Name | 4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[(1S,3S)-3-diethoxyphosphorylcyclopentyl]aniline |
|---|---|
| PubChem CID | 58404534 |
| Molecular Formula | C26H33ClN3O5P |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 4-[3-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[(1S,3S)-3-diethoxyphosphorylcyclopentyl]aniline |
| SMILES | CCOP(=O)(OCC)[C@H]1CC[C@H](Nc2ccc(-c3nc(-c4ccc(OC(C)C)c(Cl)c4)no3)cc2)C1 |
| InChI | InChI=1S/C26H33ClN3O5P/c1-5-32-36(31,33-6-2)22-13-12-21(16-22)28-20-10-7-18(8-11-20)26-29-25(30-35-26)19-9-14-24(23(27)15-19)34-17(3)4/h7-11,14-15,17,21-22,28H,5-6,12-13,16H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | VFGWYCRUZHBFFV-VXKWHMMOSA-N |
| XLogP | 7.44 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|