About 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole
2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole (PubChem CID 58405104) has the molecular formula C18H17ClN2O2S
and a molecular weight of 360.87 g/mol. Its IUPAC name is 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole |
| PubChem CID | 58405104 |
| Molecular Formula | C18H17ClN2O2S |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole |
| SMILES | CC(Oc1ccc(Cl)cc1OC1CNC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17ClN2O2S/c1-11(18-21-14-4-2-3-5-17(14)24-18)22-15-7-6-12(19)8-16(15)23-13-9-20-10-13/h2-8,11,13,20H,9-10H2,1H3 |
| InChIKey | NIPXEVDPURKXBR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole?
The IUPAC name of 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole (CID 58405104) is 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole?
The canonical SMILES for 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole is CC(Oc1ccc(Cl)cc1OC1CNC1)c1nc2ccccc2s1.
What is the InChIKey of 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole?
The InChIKey is NIPXEVDPURKXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O2S/c1-11(18-21-14-4-2-3-5-17(14)24-18)22-15-7-6-12(19)8-16(15)23-13-9-20-10-13/h2-8,11,13,20H,9-10H2,1H3.
What are the key properties of 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole?
2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole has a molecular weight of 360.87 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(azetidin-3-yloxy)-4-chlorophenoxy]ethyl]-1,3-benzothiazole is sourced from PubChem (CID 58405104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).