C17H14ClF4NO2 — CID 58405153
3-[5-chloro-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenoxy]azetidine (PubChem CID 58405153) has the molecular formula C17H14ClF4NO2 and a molecular weight of 375.75 g/mol. Its IUPAC name is 3-[5-chloro-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenoxy]azetidine.
| Compound Name | 3-[5-chloro-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenoxy]azetidine |
|---|---|
| PubChem CID | 58405153 |
| Molecular Formula | C17H14ClF4NO2 |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3-[5-chloro-2-[[4-fluoro-3-(trifluoromethyl)phenyl]methoxy]phenoxy]azetidine |
| SMILES | Fc1ccc(COc2ccc(Cl)cc2OC2CNC2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H14ClF4NO2/c18-11-2-4-15(16(6-11)25-12-7-23-8-12)24-9-10-1-3-14(19)13(5-10)17(20,21)22/h1-6,12,23H,7-9H2 |
| InChIKey | IBDDLEGVRPTKEI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |