About 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one
2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one (PubChem CID 584052) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one |
| PubChem CID | 584052 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one |
| SMILES | COc1nc(C)c2c(=O)cc(C)[nH]c2n1 |
| InChI | InChI=1S/C10H11N3O2/c1-5-4-7(14)8-6(2)12-10(15-3)13-9(8)11-5/h4H,1-3H3,(H,11,12,13,14) |
| InChIKey | VNQVKPYBIOIAGW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one?
The IUPAC name of 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one (CID 584052) is 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one.
What is the SMILES notation for 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one?
The canonical SMILES for 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one is COc1nc(C)c2c(=O)cc(C)[nH]c2n1.
What is the InChIKey of 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one?
The InChIKey is VNQVKPYBIOIAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-5-4-7(14)8-6(2)12-10(15-3)13-9(8)11-5/h4H,1-3H3,(H,11,12,13,14).
What are the key properties of 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one?
2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one has a molecular weight of 205.22 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,7-dimethyl-8H-pyrido[2,3-d]pyrimidin-5-one is sourced from PubChem (CID 584052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).