C14H19F3N4O — CID 58405299
7-ethyl-2,5,7-trimethyl-8-(3,3,3-trifluoropropyl)pteridin-6-one (PubChem CID 58405299) has the molecular formula C14H19F3N4O and a molecular weight of 316.33 g/mol. Its IUPAC name is 7-ethyl-2,5,7-trimethyl-8-(3,3,3-trifluoropropyl)pteridin-6-one.
| Compound Name | 7-ethyl-2,5,7-trimethyl-8-(3,3,3-trifluoropropyl)pteridin-6-one |
|---|---|
| PubChem CID | 58405299 |
| Molecular Formula | C14H19F3N4O |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 7-ethyl-2,5,7-trimethyl-8-(3,3,3-trifluoropropyl)pteridin-6-one |
| SMILES | CCC1(C)C(=O)N(C)c2cnc(C)nc2N1CCC(F)(F)F |
| InChI | InChI=1S/C14H19F3N4O/c1-5-13(3)12(22)20(4)10-8-18-9(2)19-11(10)21(13)7-6-14(15,16)17/h8H,5-7H2,1-4H3 |
| InChIKey | FJXGOGSXCFTUME-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |