C24H25N5O — CID 58405739
(7R)-8-cyclobutyl-7-ethyl-5-methyl-2-(3-phenyl-4-pyridinyl)-7H-pteridin-6-one (PubChem CID 58405739) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is (7R)-8-cyclobutyl-7-ethyl-5-methyl-2-(3-phenyl-4-pyridinyl)-7H-pteridin-6-one.
| Compound Name | (7R)-8-cyclobutyl-7-ethyl-5-methyl-2-(3-phenyl-4-pyridinyl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 58405739 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (7R)-8-cyclobutyl-7-ethyl-5-methyl-2-(3-phenyl-4-pyridinyl)-7H-pteridin-6-one |
| SMILES | CC[C@@H]1C(=O)N(C)c2cnc(-c3ccncc3-c3ccccc3)nc2N1C1CCC1 |
| InChI | InChI=1S/C24H25N5O/c1-3-20-24(30)28(2)21-15-26-22(27-23(21)29(20)17-10-7-11-17)18-12-13-25-14-19(18)16-8-5-4-6-9-16/h4-6,8-9,12-15,17,20H,3,7,10-11H2,1-2H3/t20-/m1/s1 |
| InChIKey | ZCDGVJDRPBDBIB-HXUWFJFHSA-N |
| XLogP | 4.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |