C29H34N4O2 — CID 58405960
2-[[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione (PubChem CID 58405960) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione.
| Compound Name | 2-[[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
|---|---|
| PubChem CID | 58405960 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2-[[4-(3-piperidin-4-ylpropyl)piperidin-1-yl]methyl]-3H-naphtho[3,2-e]benzimidazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1[nH]c(CN3CCC(CCCC4CCNCC4)CC3)nc21 |
| InChI | InChI=1S/C29H34N4O2/c34-28-21-6-1-2-7-22(21)29(35)26-23(28)8-9-24-27(26)32-25(31-24)18-33-16-12-20(13-17-33)5-3-4-19-10-14-30-15-11-19/h1-2,6-9,19-20,30H,3-5,10-18H2,(H,31,32) |
| InChIKey | ZFDFKCHZSOIMMB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|