C16H16FN3OS2 — CID 58405983
(4aR,8aR)-8a-[4-(2-fluoro-3-pyridinyl)thiophen-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 58405983) has the molecular formula C16H16FN3OS2 and a molecular weight of 349.46 g/mol. Its IUPAC name is (4aR,8aR)-8a-[4-(2-fluoro-3-pyridinyl)thiophen-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aR)-8a-[4-(2-fluoro-3-pyridinyl)thiophen-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 58405983 |
| Molecular Formula | C16H16FN3OS2 |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (4aR,8aR)-8a-[4-(2-fluoro-3-pyridinyl)thiophen-2-yl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(-c4cccnc4F)cs3)COCC[C@H]2CS1 |
| InChI | InChI=1S/C16H16FN3OS2/c17-14-12(2-1-4-19-14)10-6-13(22-7-10)16-9-21-5-3-11(16)8-23-15(18)20-16/h1-2,4,6-7,11H,3,5,8-9H2,(H2,18,20)/t11-,16-/m0/s1 |
| InChIKey | WFHNZHAZKGSOIA-ZBEGNZNMSA-N |
| XLogP | 3.24 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|