C22H22FNO3S — CID 58405990
2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 58405990) has the molecular formula C22H22FNO3S and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 58405990 |
| Molecular Formula | C22H22FNO3S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-methoxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | CO[C@H]1COC[C@]2(c3ccccc3F)N=C(CC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C22H22FNO3S/c1-26-20-12-27-14-22(16-9-5-6-10-18(16)23)17(20)13-28-21(24-22)11-19(25)15-7-3-2-4-8-15/h2-10,17,20H,11-14H2,1H3/t17-,20+,22-/m1/s1 |
| InChIKey | TZWZZSOPORXRQH-PIPMEXSNSA-N |
| XLogP | 4.10 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |