C13H15FN2OS — CID 58406002
(4aR,8aS)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 58406002) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is (4aR,8aS)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 58406002 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (4aR,8aS)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccccc3F)COCC[C@H]2CS1 |
| InChI | InChI=1S/C13H15FN2OS/c14-11-4-2-1-3-10(11)13-8-17-6-5-9(13)7-18-12(15)16-13/h1-4,9H,5-8H2,(H2,15,16)/t9-,13-/m0/s1 |
| InChIKey | WTXBHLMRVJGNPZ-ZANVPECISA-N |
| XLogP | 2.12 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |