C21H19BrFNO2S — CID 58406049
2-[(4aR,8aS)-8a-(5-bromo-2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 58406049) has the molecular formula C21H19BrFNO2S and a molecular weight of 448.36 g/mol. Its IUPAC name is 2-[(4aR,8aS)-8a-(5-bromo-2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aR,8aS)-8a-(5-bromo-2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 58406049 |
| Molecular Formula | C21H19BrFNO2S |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-[(4aR,8aS)-8a-(5-bromo-2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3cc(Br)ccc3F)COCC[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H19BrFNO2S/c22-16-6-7-18(23)17(10-16)21-13-26-9-8-15(21)12-27-20(24-21)11-19(25)14-4-2-1-3-5-14/h1-7,10,15H,8-9,11-13H2/t15-,21-/m0/s1 |
| InChIKey | NFCUZFQYCGMIHA-BTYIYWSLSA-N |
| XLogP | 5.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |