C11H13BrN2OS2 — CID 58406053
(4aR,8aR)-8a-(4-bromothiophen-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 58406053) has the molecular formula C11H13BrN2OS2 and a molecular weight of 333.28 g/mol. Its IUPAC name is (4aR,8aR)-8a-(4-bromothiophen-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aR)-8a-(4-bromothiophen-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 58406053 |
| Molecular Formula | C11H13BrN2OS2 |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | (4aR,8aR)-8a-(4-bromothiophen-2-yl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(Br)cs3)COCC[C@H]2CS1 |
| InChI | InChI=1S/C11H13BrN2OS2/c12-8-3-9(16-5-8)11-6-15-2-1-7(11)4-17-10(13)14-11/h3,5,7H,1-2,4,6H2,(H2,13,14)/t7-,11-/m0/s1 |
| InChIKey | MJXZDBNWYMOSOL-CPCISQLKSA-N |
| XLogP | 2.80 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |