About [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol
[(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol (PubChem CID 58406100) has the molecular formula C13H18FNO2
and a molecular weight of 239.29 g/mol. Its IUPAC name is [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol |
| PubChem CID | 58406100 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol |
| SMILES | C[C@H]1C[C@@H](CO)[C@](N)(c2ccccc2F)CO1 |
| InChI | InChI=1S/C13H18FNO2/c1-9-6-10(7-16)13(15,8-17-9)11-4-2-3-5-12(11)14/h2-5,9-10,16H,6-8,15H2,1H3/t9-,10-,13-/m0/s1 |
| InChIKey | TXZBHQKKUZTQSO-KWBADKCTSA-N |
| XLogP | 1.40 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol?
The IUPAC name of [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol (CID 58406100) is [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol.
What is the SMILES notation for [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol?
The canonical SMILES for [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol is C[C@H]1C[C@@H](CO)[C@](N)(c2ccccc2F)CO1.
What is the InChIKey of [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol?
The InChIKey is TXZBHQKKUZTQSO-KWBADKCTSA-N. The full InChI is InChI=1S/C13H18FNO2/c1-9-6-10(7-16)13(15,8-17-9)11-4-2-3-5-12(11)14/h2-5,9-10,16H,6-8,15H2,1H3/t9-,10-,13-/m0/s1.
What are the key properties of [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol?
[(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol has a molecular weight of 239.29 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R,5S)-5-amino-5-(2-fluorophenyl)-2-methyloxan-4-yl]methanol is sourced from PubChem (CID 58406100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).