C23H24FNO3S — CID 58406111
2-[(4aR,6R,8aS)-8a-(2-fluorophenyl)-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 58406111) has the molecular formula C23H24FNO3S and a molecular weight of 413.51 g/mol. Its IUPAC name is 2-[(4aR,6R,8aS)-8a-(2-fluorophenyl)-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aR,6R,8aS)-8a-(2-fluorophenyl)-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 58406111 |
| Molecular Formula | C23H24FNO3S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[(4aR,6R,8aS)-8a-(2-fluorophenyl)-6-(methoxymethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | COC[C@H]1C[C@H]2CSC(CC(=O)c3ccccc3)=N[C@@]2(c2ccccc2F)CO1 |
| InChI | InChI=1S/C23H24FNO3S/c1-27-13-18-11-17-14-29-22(12-21(26)16-7-3-2-4-8-16)25-23(17,15-28-18)19-9-5-6-10-20(19)24/h2-10,17-18H,11-15H2,1H3/t17-,18+,23-/m0/s1 |
| InChIKey | IUDSPTCGKPJQST-IXFSTUDKSA-N |
| XLogP | 4.49 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |