C20H24BrF2NO3S — CID 58406130
tert-butyl 2-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]acetate (PubChem CID 58406130) has the molecular formula C20H24BrF2NO3S and a molecular weight of 476.38 g/mol. Its IUPAC name is tert-butyl 2-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]acetate.
| Compound Name | tert-butyl 2-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]acetate |
|---|---|
| PubChem CID | 58406130 |
| Molecular Formula | C20H24BrF2NO3S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | tert-butyl 2-[(4aR,6R,8aS)-8a-(5-bromo-2-fluorophenyl)-6-(fluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1=N[C@@]2(c3cc(Br)ccc3F)CO[C@@H](CF)C[C@H]2CS1 |
| InChI | InChI=1S/C20H24BrF2NO3S/c1-19(2,3)27-18(25)8-17-24-20(15-7-13(21)4-5-16(15)23)11-26-14(9-22)6-12(20)10-28-17/h4-5,7,12,14H,6,8-11H2,1-3H3/t12-,14+,20-/m0/s1 |
| InChIKey | MUXNKEZMSHYHII-HKMRUAMVSA-N |
| XLogP | 5.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |