C21H20FNO3S — CID 58406134
2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-hydroxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 58406134) has the molecular formula C21H20FNO3S and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-hydroxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-hydroxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 58406134 |
| Molecular Formula | C21H20FNO3S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[(4aS,5R,8aS)-8a-(2-fluorophenyl)-5-hydroxy-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3ccccc3F)COC[C@H](O)[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H20FNO3S/c22-17-9-5-4-8-15(17)21-13-26-11-19(25)16(21)12-27-20(23-21)10-18(24)14-6-2-1-3-7-14/h1-9,16,19,25H,10-13H2/t16-,19+,21-/m1/s1 |
| InChIKey | KYOSFDGUTYLRTO-LKUPVBHCSA-N |
| XLogP | 3.45 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |